C30H30O5 — CID 150651802
[4-[4-[3-oxo-3-[4-(2-prop-1-enoxyethyl)phenoxy]propyl]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 150651802) has the molecular formula C30H30O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is [4-[4-[3-oxo-3-[4-(2-prop-1-enoxyethyl)phenoxy]propyl]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[3-oxo-3-[4-(2-prop-1-enoxyethyl)phenoxy]propyl]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 150651802 |
| Molecular Formula | C30H30O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | [4-[4-[3-oxo-3-[4-(2-prop-1-enoxyethyl)phenoxy]propyl]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(CCC(=O)Oc3ccc(CCOC=CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H30O5/c1-4-20-33-21-19-24-7-14-27(15-8-24)34-29(31)18-9-23-5-10-25(11-6-23)26-12-16-28(17-13-26)35-30(32)22(2)3/h4-8,10-17,20H,2,9,18-19,21H2,1,3H3 |
| InChIKey | JCAKEXZNPUADNR-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|