C13H18IN3O — CID 15065587
1-[4-(3,5-dimethylimidazol-3-ium-1-yl)but-2-ynyl]pyrrolidin-2-one iodide (PubChem CID 15065587) has the molecular formula C13H18IN3O and a molecular weight of 359.21 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylimidazol-3-ium-1-yl)but-2-ynyl]pyrrolidin-2-one iodide.
| Compound Name | 1-[4-(3,5-dimethylimidazol-3-ium-1-yl)but-2-ynyl]pyrrolidin-2-one iodide |
|---|---|
| PubChem CID | 15065587 |
| Molecular Formula | C13H18IN3O |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 1-[4-(3,5-dimethylimidazol-3-ium-1-yl)but-2-ynyl]pyrrolidin-2-one iodide |
| SMILES | Cc1c[n+](C)cn1CC#CCN1CCCC1=O.[I-] |
| InChI | InChI=1S/C13H18N3O.HI/c1-12-10-14(2)11-16(12)8-4-3-7-15-9-5-6-13(15)17;/h10-11H,5-9H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | KWCRTVGXKRCRNF-UHFFFAOYSA-M |
| XLogP | -2.75 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|