C33H36N2O7S3 — CID 15066389
2-[(2Z)-2-[(2E)-2-[[5,6-dimethyl-3-(4-sulfobutyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzoxazol-3-yl]ethanesulfonate (PubChem CID 15066389) has the molecular formula C33H36N2O7S3 and a molecular weight of 668.86 g/mol. Its IUPAC name is 2-[(2Z)-2-[(2E)-2-[[5,6-dimethyl-3-(4-sulfobutyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzoxazol-3-yl]ethanesulfonate.
| Compound Name | 2-[(2Z)-2-[(2E)-2-[[5,6-dimethyl-3-(4-sulfobutyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzoxazol-3-yl]ethanesulfonate |
|---|---|
| PubChem CID | 15066389 |
| Molecular Formula | C33H36N2O7S3 |
| Molecular Weight | 668.86 g/mol |
| Exact Mass | 668.17 |
| IUPAC Name | 2-[(2Z)-2-[(2E)-2-[[5,6-dimethyl-3-(4-sulfobutyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]-5-phenyl-1,3-benzoxazol-3-yl]ethanesulfonate |
| SMILES | CCC(/C=C1\Oc2ccc(-c3ccccc3)cc2N1CCS(=O)(=O)[O-])=C\c1sc2cc(C)c(C)cc2[n+]1CCCCS(=O)(=O)O |
| InChI | InChI=1S/C33H36N2O7S3/c1-4-25(21-33-35(14-8-9-16-44(36,37)38)29-18-23(2)24(3)19-31(29)43-33)20-32-34(15-17-45(39,40)41)28-22-27(12-13-30(28)42-32)26-10-6-5-7-11-26/h5-7,10-13,18-22H,4,8-9,14-17H2,1-3H3,(H-,36,37,38,39,40,41) |
| InChIKey | KJYJUERSVXNBHN-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.86 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|