C21H23F3N6O3 — CID 150670207
2-[3-[5-amino-6-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)pyrazin-2-yl]-4-methylphenyl]-3,3,3-trifluoro-2-hydroxypropanamide (PubChem CID 150670207) has the molecular formula C21H23F3N6O3 and a molecular weight of 464.45 g/mol. Its IUPAC name is 2-[3-[5-amino-6-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)pyrazin-2-yl]-4-methylphenyl]-3,3,3-trifluoro-2-hydroxypropanamide.
| Compound Name | 2-[3-[5-amino-6-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)pyrazin-2-yl]-4-methylphenyl]-3,3,3-trifluoro-2-hydroxypropanamide |
|---|---|
| PubChem CID | 150670207 |
| Molecular Formula | C21H23F3N6O3 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 2-[3-[5-amino-6-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)pyrazin-2-yl]-4-methylphenyl]-3,3,3-trifluoro-2-hydroxypropanamide |
| SMILES | Cc1ccc(C(O)(C(N)=O)C(F)(F)F)cc1-c1cnc(N)c(N2CCN3C(=O)CCC3C2)n1 |
| InChI | InChI=1S/C21H23F3N6O3/c1-11-2-3-12(20(33,19(26)32)21(22,23)24)8-14(11)15-9-27-17(25)18(28-15)29-6-7-30-13(10-29)4-5-16(30)31/h2-3,8-9,13,33H,4-7,10H2,1H3,(H2,25,27)(H2,26,32) |
| InChIKey | JFSJGUFSTAKAGV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |