C32H52N2O — CID 150679563
7-hexyl-7-(6-pyridin-2-yl-3-pyridinyl)hexadecan-8-ol (PubChem CID 150679563) has the molecular formula C32H52N2O and a molecular weight of 480.78 g/mol. Its IUPAC name is 7-hexyl-7-(6-pyridin-2-yl-3-pyridinyl)hexadecan-8-ol.
| Compound Name | 7-hexyl-7-(6-pyridin-2-yl-3-pyridinyl)hexadecan-8-ol |
|---|---|
| PubChem CID | 150679563 |
| Molecular Formula | C32H52N2O |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 480.41 |
| IUPAC Name | 7-hexyl-7-(6-pyridin-2-yl-3-pyridinyl)hexadecan-8-ol |
| SMILES | CCCCCCCCC(O)C(CCCCCC)(CCCCCC)c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C32H52N2O/c1-4-7-10-13-14-15-21-31(35)32(24-17-11-8-5-2,25-18-12-9-6-3)28-22-23-30(34-27-28)29-20-16-19-26-33-29/h16,19-20,22-23,26-27,31,35H,4-15,17-18,21,24-25H2,1-3H3 |
| InChIKey | JHOZGLCDJGPXPK-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|