C20H38O3Si — CID 150681110
(7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,9-trimethylundeca-9,10-dienoic acid (PubChem CID 150681110) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is (7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,9-trimethylundeca-9,10-dienoic acid.
| Compound Name | (7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,9-trimethylundeca-9,10-dienoic acid |
|---|---|
| PubChem CID | 150681110 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,9-trimethylundeca-9,10-dienoic acid |
| SMILES | C=C=C(C)C[C@@H](CCCCC(C)(C)C(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O3Si/c1-10-16(2)15-17(23-24(8,9)19(3,4)5)13-11-12-14-20(6,7)18(21)22/h17H,1,11-15H2,2-9H3,(H,21,22)/t17-/m1/s1 |
| InChIKey | JHWUEUPVSZMQIT-QGZVFWFLSA-N |
| XLogP | 6.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|