About 5,6-dichloro-2-benzofuran
5,6-dichloro-2-benzofuran (PubChem CID 150692512) has the molecular formula C8H4Cl2O
and a molecular weight of 187.03 g/mol. Its IUPAC name is 5,6-dichloro-2-benzofuran.
Molecular Properties
| Compound Name | 5,6-dichloro-2-benzofuran |
| PubChem CID | 150692512 |
| Molecular Formula | C8H4Cl2O |
| Molecular Weight | 187.03 g/mol |
| Exact Mass | 185.96 |
| IUPAC Name | 5,6-dichloro-2-benzofuran |
| SMILES | Clc1cc2cocc2cc1Cl |
| InChI | InChI=1S/C8H4Cl2O/c9-7-1-5-3-11-4-6(5)2-8(7)10/h1-4H |
| InChIKey | JKEHDTBPTDYEHF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.03 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,6-dichloro-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-2-benzofuran?
The IUPAC name of 5,6-dichloro-2-benzofuran (CID 150692512) is 5,6-dichloro-2-benzofuran.
What is the SMILES notation for 5,6-dichloro-2-benzofuran?
The canonical SMILES for 5,6-dichloro-2-benzofuran is Clc1cc2cocc2cc1Cl.
What is the InChIKey of 5,6-dichloro-2-benzofuran?
The InChIKey is JKEHDTBPTDYEHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Cl2O/c9-7-1-5-3-11-4-6(5)2-8(7)10/h1-4H.
What are the key properties of 5,6-dichloro-2-benzofuran?
5,6-dichloro-2-benzofuran has a molecular weight of 187.03 g/mol, XLogP of 3.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-2-benzofuran is sourced from PubChem (CID 150692512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).