C5H10O7P2 — CID 150700339
(4,4-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinin-2-yl) dihydrogen phosphate (PubChem CID 150700339) has the molecular formula C5H10O7P2 and a molecular weight of 244.08 g/mol. Its IUPAC name is (4,4-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinin-2-yl) dihydrogen phosphate.
| Compound Name | (4,4-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinin-2-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 150700339 |
| Molecular Formula | C5H10O7P2 |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | (4,4-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinin-2-yl) dihydrogen phosphate |
| SMILES | CC1(C)C=COP(=O)(OP(=O)(O)O)O1 |
| InChI | InChI=1S/C5H10O7P2/c1-5(2)3-4-10-14(9,11-5)12-13(6,7)8/h3-4H,1-2H3,(H2,6,7,8) |
| InChIKey | JLSVHUPGGLKJQN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|