C2H2O9P2 — CID 175202282
(2,4,5-trioxo-1,3,2λ5-dioxaphospholan-2-yl) dihydrogen phosphate (PubChem CID 175202282) has the molecular formula C2H2O9P2 and a molecular weight of 231.98 g/mol. Its IUPAC name is (2,4,5-trioxo-1,3,2λ5-dioxaphospholan-2-yl) dihydrogen phosphate.
| Compound Name | (2,4,5-trioxo-1,3,2λ5-dioxaphospholan-2-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 175202282 |
| Molecular Formula | C2H2O9P2 |
| Molecular Weight | 231.98 g/mol |
| Exact Mass | 231.92 |
| IUPAC Name | (2,4,5-trioxo-1,3,2λ5-dioxaphospholan-2-yl) dihydrogen phosphate |
| SMILES | O=C1OP(=O)(OP(=O)(O)O)OC1=O |
| InChI | InChI=1S/C2H2O9P2/c3-1-2(4)10-13(8,9-1)11-12(5,6)7/h(H2,5,6,7) |
| InChIKey | PSTFWOCHECSRGH-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.98 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|