C12H8Cl3O8P3 — CID 142711299
3-chloro-11-dichlorophosphoryloxy-2,4,10,12-tetraoxa-3λ5,11λ5-diphosphatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaene 3,11-dioxide (PubChem CID 142711299) has the molecular formula C12H8Cl3O8P3 and a molecular weight of 479.47 g/mol. Its IUPAC name is 3-chloro-11-dichlorophosphoryloxy-2,4,10,12-tetraoxa-3λ5,11λ5-diphosphatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaene 3,11-dioxide.
| Compound Name | 3-chloro-11-dichlorophosphoryloxy-2,4,10,12-tetraoxa-3λ5,11λ5-diphosphatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaene 3,11-dioxide |
|---|---|
| PubChem CID | 142711299 |
| Molecular Formula | C12H8Cl3O8P3 |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 477.85 |
| IUPAC Name | 3-chloro-11-dichlorophosphoryloxy-2,4,10,12-tetraoxa-3λ5,11λ5-diphosphatricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaene 3,11-dioxide |
| SMILES | O=P(Cl)(Cl)OP1(=O)Oc2cccc(c2)OP(=O)(Cl)Oc2cccc(c2)O1 |
| InChI | InChI=1S/C12H8Cl3O8P3/c13-24(14,16)23-26(18)21-11-5-1-3-9(7-11)19-25(15,17)20-10-4-2-6-12(8-10)22-26/h1-8H |
| InChIKey | ATOBYNNIFVUWQT-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|