C25H27O4P — CID 139891935
11-(2,6-dimethylphenoxy)-1,3,7,9-tetramethyl-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide (PubChem CID 139891935) has the molecular formula C25H27O4P and a molecular weight of 422.46 g/mol. Its IUPAC name is 11-(2,6-dimethylphenoxy)-1,3,7,9-tetramethyl-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide.
| Compound Name | 11-(2,6-dimethylphenoxy)-1,3,7,9-tetramethyl-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
|---|---|
| PubChem CID | 139891935 |
| Molecular Formula | C25H27O4P |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 11-(2,6-dimethylphenoxy)-1,3,7,9-tetramethyl-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
| SMILES | Cc1cc(C)c2c(c1)Cc1cc(C)cc(C)c1OP(=O)(Oc1c(C)cccc1C)O2 |
| InChI | InChI=1S/C25H27O4P/c1-15-10-19(5)24-21(12-15)14-22-13-16(2)11-20(6)25(22)29-30(26,28-24)27-23-17(3)8-7-9-18(23)4/h7-13H,14H2,1-6H3 |
| InChIKey | RNEQVERTXUANAP-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|