C24H25O4P — CID 139891959
11-(2,4-dimethylphenoxy)-1,5,9-trimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide (PubChem CID 139891959) has the molecular formula C24H25O4P and a molecular weight of 408.43 g/mol. Its IUPAC name is 11-(2,4-dimethylphenoxy)-1,5,9-trimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide.
| Compound Name | 11-(2,4-dimethylphenoxy)-1,5,9-trimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
|---|---|
| PubChem CID | 139891959 |
| Molecular Formula | C24H25O4P |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 11-(2,4-dimethylphenoxy)-1,5,9-trimethyl-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
| SMILES | Cc1ccc(OP2(=O)Oc3c(C)cccc3C(C)c3cccc(C)c3O2)c(C)c1 |
| InChI | InChI=1S/C24H25O4P/c1-15-12-13-22(18(4)14-15)26-29(25)27-23-16(2)8-6-10-20(23)19(5)21-11-7-9-17(3)24(21)28-29/h6-14,19H,1-5H3 |
| InChIKey | PRHVJCQBAIIGKF-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|