C48H56N3O6P3+2 — CID 87844133
2,2,4,4,6,6-hexakis(2,4-dimethylphenoxy)-1,3,5-triaza-4λ5-phospha-2,6-diphosphoniacyclohex-4-ene (PubChem CID 87844133) has the molecular formula C48H56N3O6P3+2 and a molecular weight of 863.91 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexakis(2,4-dimethylphenoxy)-1,3,5-triaza-4λ5-phospha-2,6-diphosphoniacyclohex-4-ene.
| Compound Name | 2,2,4,4,6,6-hexakis(2,4-dimethylphenoxy)-1,3,5-triaza-4λ5-phospha-2,6-diphosphoniacyclohex-4-ene |
|---|---|
| PubChem CID | 87844133 |
| Molecular Formula | C48H56N3O6P3+2 |
| Molecular Weight | 863.91 g/mol |
| Exact Mass | 863.34 |
| IUPAC Name | 2,2,4,4,6,6-hexakis(2,4-dimethylphenoxy)-1,3,5-triaza-4λ5-phospha-2,6-diphosphoniacyclohex-4-ene |
| SMILES | Cc1ccc(OP2(Oc3ccc(C)cc3C)=N[P+](Oc3ccc(C)cc3C)(Oc3ccc(C)cc3C)N[P+](Oc3ccc(C)cc3C)(Oc3ccc(C)cc3C)N2)c(C)c1 |
| InChI | InChI=1S/C48H56N3O6P3/c1-31-13-19-43(37(7)25-31)52-58(53-44-20-14-32(2)26-38(44)8)49-59(54-45-21-15-33(3)27-39(45)9,55-46-22-16-34(4)28-40(46)10)51-60(50-58,56-47-23-17-35(5)29-41(47)11)57-48-24-18-36(6)30-42(48)12/h13-30,49-50H,1-12H3/q+2 |
| InChIKey | NRJNGCHOEIDQPR-UHFFFAOYSA-N |
| XLogP | 14.66 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.91 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|