C48H43N4O8P4+3 — CID 87104130
2,2,4,4,6,6,8,8-octaphenoxy-1,3,5,7-tetraza-6λ5-phospha-2,4,8-triphosphoniacyclooct-6-ene (PubChem CID 87104130) has the molecular formula C48H43N4O8P4+3 and a molecular weight of 927.79 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8-octaphenoxy-1,3,5,7-tetraza-6λ5-phospha-2,4,8-triphosphoniacyclooct-6-ene.
| Compound Name | 2,2,4,4,6,6,8,8-octaphenoxy-1,3,5,7-tetraza-6λ5-phospha-2,4,8-triphosphoniacyclooct-6-ene |
|---|---|
| PubChem CID | 87104130 |
| Molecular Formula | C48H43N4O8P4+3 |
| Molecular Weight | 927.79 g/mol |
| Exact Mass | 927.20 |
| IUPAC Name | 2,2,4,4,6,6,8,8-octaphenoxy-1,3,5,7-tetraza-6λ5-phospha-2,4,8-triphosphoniacyclooct-6-ene |
| SMILES | c1ccc(OP2(Oc3ccccc3)=N[P+](Oc3ccccc3)(Oc3ccccc3)N[P+](Oc3ccccc3)(Oc3ccccc3)N[P+](Oc3ccccc3)(Oc3ccccc3)N2)cc1 |
| InChI | InChI=1S/C48H43N4O8P4/c1-9-25-41(26-10-1)53-61(54-42-27-11-2-12-28-42)49-62(55-43-29-13-3-14-30-43,56-44-31-15-4-16-32-44)51-64(59-47-37-21-7-22-38-47,60-48-39-23-8-24-40-48)52-63(50-61,57-45-33-17-5-18-34-45)58-46-35-19-6-20-36-46/h1-40,49-51H/q+3 |
| InChIKey | KHXXIXQMWOLUTA-UHFFFAOYSA-N |
| XLogP | 14.38 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.79 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|