C30H44N3O6P3+2 — CID 23614936
2,4,6-tris(4-methylphenoxy)-2,4,6-tripropoxy-1,3,5-triaza-4λ5-phospha-2,6-diphosphoniacyclohex-4-ene (PubChem CID 23614936) has the molecular formula C30H44N3O6P3+2 and a molecular weight of 635.62 g/mol. Its IUPAC name is 2,4,6-tris(4-methylphenoxy)-2,4,6-tripropoxy-1,3,5-triaza-4λ5-phospha-2,6-diphosphoniacyclohex-4-ene.
| Compound Name | 2,4,6-tris(4-methylphenoxy)-2,4,6-tripropoxy-1,3,5-triaza-4λ5-phospha-2,6-diphosphoniacyclohex-4-ene |
|---|---|
| PubChem CID | 23614936 |
| Molecular Formula | C30H44N3O6P3+2 |
| Molecular Weight | 635.62 g/mol |
| Exact Mass | 635.24 |
| IUPAC Name | 2,4,6-tris(4-methylphenoxy)-2,4,6-tripropoxy-1,3,5-triaza-4λ5-phospha-2,6-diphosphoniacyclohex-4-ene |
| SMILES | CCCOP1(Oc2ccc(C)cc2)=N[P+](OCCC)(Oc2ccc(C)cc2)N[P+](OCCC)(Oc2ccc(C)cc2)N1 |
| InChI | InChI=1S/C30H44N3O6P3/c1-7-22-34-40(37-28-16-10-25(4)11-17-28)31-41(35-23-8-2,38-29-18-12-26(5)13-19-29)33-42(32-40,36-24-9-3)39-30-20-14-27(6)15-21-30/h10-21,31-32H,7-9,22-24H2,1-6H3/q+2 |
| InChIKey | DFSRXGRZHLCLDQ-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.62 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|