C33H50N3O6P3+2 — CID 23614916
2,4,6-tributoxy-2,4,6-tris(4-methylphenoxy)-1,3,5-triaza-4λ5-phospha-2,6-diphosphoniacyclohex-4-ene (PubChem CID 23614916) has the molecular formula C33H50N3O6P3+2 and a molecular weight of 677.70 g/mol. Its IUPAC name is 2,4,6-tributoxy-2,4,6-tris(4-methylphenoxy)-1,3,5-triaza-4λ5-phospha-2,6-diphosphoniacyclohex-4-ene.
| Compound Name | 2,4,6-tributoxy-2,4,6-tris(4-methylphenoxy)-1,3,5-triaza-4λ5-phospha-2,6-diphosphoniacyclohex-4-ene |
|---|---|
| PubChem CID | 23614916 |
| Molecular Formula | C33H50N3O6P3+2 |
| Molecular Weight | 677.70 g/mol |
| Exact Mass | 677.29 |
| IUPAC Name | 2,4,6-tributoxy-2,4,6-tris(4-methylphenoxy)-1,3,5-triaza-4λ5-phospha-2,6-diphosphoniacyclohex-4-ene |
| SMILES | CCCCOP1(Oc2ccc(C)cc2)=N[P+](OCCCC)(Oc2ccc(C)cc2)N[P+](OCCCC)(Oc2ccc(C)cc2)N1 |
| InChI | InChI=1S/C33H50N3O6P3/c1-7-10-25-37-43(40-31-19-13-28(4)14-20-31)34-44(38-26-11-8-2,41-32-21-15-29(5)16-22-32)36-45(35-43,39-27-12-9-3)42-33-23-17-30(6)18-24-33/h13-24,34-35H,7-12,25-27H2,1-6H3/q+2 |
| InChIKey | FDIFKKLYZBVMPB-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.70 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|