C27H31O3P — CID 22967870
3,7-dimethyl-11-phenyl-1,9-di(propan-2-yl)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide (PubChem CID 22967870) has the molecular formula C27H31O3P and a molecular weight of 434.52 g/mol. Its IUPAC name is 3,7-dimethyl-11-phenyl-1,9-di(propan-2-yl)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide.
| Compound Name | 3,7-dimethyl-11-phenyl-1,9-di(propan-2-yl)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
|---|---|
| PubChem CID | 22967870 |
| Molecular Formula | C27H31O3P |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 3,7-dimethyl-11-phenyl-1,9-di(propan-2-yl)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
| SMILES | Cc1cc2c(c(C(C)C)c1)OP(=O)(c1ccccc1)Oc1c(cc(C)cc1C(C)C)C2 |
| InChI | InChI=1S/C27H31O3P/c1-17(2)24-14-19(5)12-21-16-22-13-20(6)15-25(18(3)4)27(22)30-31(28,29-26(21)24)23-10-8-7-9-11-23/h7-15,17-18H,16H2,1-6H3 |
| InChIKey | GMSJLIBUQRHYTQ-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|