C11H13O2P — CID 134935004
4,5-dimethyl-2-phenyl-3H-1,2λ5-oxaphosphole 2-oxide (PubChem CID 134935004) has the molecular formula C11H13O2P and a molecular weight of 208.20 g/mol. Its IUPAC name is 4,5-dimethyl-2-phenyl-3H-1,2λ5-oxaphosphole 2-oxide.
| Compound Name | 4,5-dimethyl-2-phenyl-3H-1,2λ5-oxaphosphole 2-oxide |
|---|---|
| PubChem CID | 134935004 |
| Molecular Formula | C11H13O2P |
| Molecular Weight | 208.20 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 4,5-dimethyl-2-phenyl-3H-1,2λ5-oxaphosphole 2-oxide |
| SMILES | CC1=C(C)OP(=O)(c2ccccc2)C1 |
| InChI | InChI=1S/C11H13O2P/c1-9-8-14(12,13-10(9)2)11-6-4-3-5-7-11/h3-7H,8H2,1-2H3 |
| InChIKey | KHUCHCWFVGPBDY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|