C12H9OPS2 — CID 58399828
2-phenyl-1,3,2λ5-benzodithiaphosphole 2-oxide (PubChem CID 58399828) has the molecular formula C12H9OPS2 and a molecular weight of 264.31 g/mol. Its IUPAC name is 2-phenyl-1,3,2λ5-benzodithiaphosphole 2-oxide.
| Compound Name | 2-phenyl-1,3,2λ5-benzodithiaphosphole 2-oxide |
|---|---|
| PubChem CID | 58399828 |
| Molecular Formula | C12H9OPS2 |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | 2-phenyl-1,3,2λ5-benzodithiaphosphole 2-oxide |
| SMILES | O=P1(c2ccccc2)Sc2ccccc2S1 |
| InChI | InChI=1S/C12H9OPS2/c13-14(10-6-2-1-3-7-10)15-11-8-4-5-9-12(11)16-14/h1-9H |
| InChIKey | UIADWKZTUJPUIN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|