C5H13O9P3 — CID 138510564
(2,5-dihydroxy-3,6,6-trimethyl-2,5-dioxo-1,4,2λ5,5λ5-dioxadiphosphinan-3-yl)phosphonic acid (PubChem CID 138510564) has the molecular formula C5H13O9P3 and a molecular weight of 310.07 g/mol. Its IUPAC name is (2,5-dihydroxy-3,6,6-trimethyl-2,5-dioxo-1,4,2λ5,5λ5-dioxadiphosphinan-3-yl)phosphonic acid.
| Compound Name | (2,5-dihydroxy-3,6,6-trimethyl-2,5-dioxo-1,4,2λ5,5λ5-dioxadiphosphinan-3-yl)phosphonic acid |
|---|---|
| PubChem CID | 138510564 |
| Molecular Formula | C5H13O9P3 |
| Molecular Weight | 310.07 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | (2,5-dihydroxy-3,6,6-trimethyl-2,5-dioxo-1,4,2λ5,5λ5-dioxadiphosphinan-3-yl)phosphonic acid |
| SMILES | CC1(C)OP(=O)(O)C(C)(P(=O)(O)O)OP1(=O)O |
| InChI | InChI=1S/C5H13O9P3/c1-4(2)13-17(11,12)5(3,15(6,7)8)14-16(4,9)10/h1-3H3,(H,9,10)(H,11,12)(H2,6,7,8) |
| InChIKey | DNFNXJGSWXJVDK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.07 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|