C8H21NO11P4 — CID 15733810
[3-(butylamino)-2,6-dihydroxy-5-methyl-2,6-dioxo-5-phosphono-1,2lambda5,6lambda5-oxadiphosphinan-3-yl]phosphonic acid (PubChem CID 15733810) has the molecular formula C8H21NO11P4 and a molecular weight of 431.15 g/mol. Its IUPAC name is [3-(butylamino)-2,6-dihydroxy-5-methyl-2,6-dioxo-5-phosphono-1,2lambda5,6lambda5-oxadiphosphinan-3-yl]phosphonic acid.
| Compound Name | [3-(butylamino)-2,6-dihydroxy-5-methyl-2,6-dioxo-5-phosphono-1,2lambda5,6lambda5-oxadiphosphinan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 15733810 |
| Molecular Formula | C8H21NO11P4 |
| Molecular Weight | 431.15 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | [3-(butylamino)-2,6-dihydroxy-5-methyl-2,6-dioxo-5-phosphono-1,2lambda5,6lambda5-oxadiphosphinan-3-yl]phosphonic acid |
| SMILES | CCCCNC1(P(=O)(O)O)CC(C)(P(=O)(O)O)P(=O)(O)OP1(=O)O |
| InChI | InChI=1S/C8H21NO11P4/c1-3-4-5-9-8(22(13,14)15)6-7(2,21(10,11)12)23(16,17)20-24(8,18)19/h9H,3-6H2,1-2H3,(H,16,17)(H,18,19)(H2,10,11,12)(H2,13,14,15) |
| InChIKey | HUVWUPMBUNEJTB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 210.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.15 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|