C9H22NO5PS — CID 70536554
butylaminomethylphosphonic acid;thiolane 1,1-dioxide (PubChem CID 70536554) has the molecular formula C9H22NO5PS and a molecular weight of 287.32 g/mol. Its IUPAC name is butylaminomethylphosphonic acid;thiolane 1,1-dioxide.
| Compound Name | butylaminomethylphosphonic acid;thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 70536554 |
| Molecular Formula | C9H22NO5PS |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | butylaminomethylphosphonic acid;thiolane 1,1-dioxide |
| SMILES | CCCCNCP(=O)(O)O.O=S1(=O)CCCC1 |
| InChI | InChI=1S/C5H14NO3P.C4H8O2S/c1-2-3-4-6-5-10(7,8)9;5-7(6)3-1-2-4-7/h6H,2-5H2,1H3,(H2,7,8,9);1-4H2 |
| InChIKey | QAUZFTBZKBGZPX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|