C13H15ClN2O6 — CID 150707862
3-O-(3-chloro-5-nitro-4-pyridinyl) 1-O-(2,2-dimethylpropyl) propanedioate (PubChem CID 150707862) has the molecular formula C13H15ClN2O6 and a molecular weight of 330.72 g/mol. Its IUPAC name is 3-O-(3-chloro-5-nitro-4-pyridinyl) 1-O-(2,2-dimethylpropyl) propanedioate.
| Compound Name | 3-O-(3-chloro-5-nitro-4-pyridinyl) 1-O-(2,2-dimethylpropyl) propanedioate |
|---|---|
| PubChem CID | 150707862 |
| Molecular Formula | C13H15ClN2O6 |
| Molecular Weight | 330.72 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 3-O-(3-chloro-5-nitro-4-pyridinyl) 1-O-(2,2-dimethylpropyl) propanedioate |
| SMILES | CC(C)(C)COC(=O)CC(=O)Oc1c(Cl)cncc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15ClN2O6/c1-13(2,3)7-21-10(17)4-11(18)22-12-8(14)5-15-6-9(12)16(19)20/h5-6H,4,7H2,1-3H3 |
| InChIKey | JNFZYXYJCPYPDJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 108.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.72 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|