C18H34Cl2 — CID 150712657
8-(1,1-dichloroethyl)hexadec-6-ene (PubChem CID 150712657) has the molecular formula C18H34Cl2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 8-(1,1-dichloroethyl)hexadec-6-ene.
| Compound Name | 8-(1,1-dichloroethyl)hexadec-6-ene |
|---|---|
| PubChem CID | 150712657 |
| Molecular Formula | C18H34Cl2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 8-(1,1-dichloroethyl)hexadec-6-ene |
| SMILES | CCCCCC=CC(CCCCCCCC)C(C)(Cl)Cl |
| InChI | InChI=1S/C18H34Cl2/c1-4-6-8-10-12-14-16-17(18(3,19)20)15-13-11-9-7-5-2/h13,15,17H,4-12,14,16H2,1-3H3 |
| InChIKey | JOFKNWNOPWGMBB-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|