C24H22N2O2 — CID 150728002
1'-(ethylamino)-2',7'-dimethylspiro[2H-isoindole-3,9'-xanthene]-1-one (PubChem CID 150728002) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1'-(ethylamino)-2',7'-dimethylspiro[2H-isoindole-3,9'-xanthene]-1-one.
| Compound Name | 1'-(ethylamino)-2',7'-dimethylspiro[2H-isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 150728002 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1'-(ethylamino)-2',7'-dimethylspiro[2H-isoindole-3,9'-xanthene]-1-one |
| SMILES | CCNc1c(C)ccc2c1C1(NC(=O)c3ccccc31)c1cc(C)ccc1O2 |
| InChI | InChI=1S/C24H22N2O2/c1-4-25-22-15(3)10-12-20-21(22)24(18-13-14(2)9-11-19(18)28-20)17-8-6-5-7-16(17)23(27)26-24/h5-13,25H,4H2,1-3H3,(H,26,27) |
| InChIKey | JRFWZJMNMCDXFA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |