C28H31N3O2 — CID 175720235
1',2'-bis(diethylamino)spiro[2H-isoindole-3,9'-xanthene]-1-one (PubChem CID 175720235) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 1',2'-bis(diethylamino)spiro[2H-isoindole-3,9'-xanthene]-1-one.
| Compound Name | 1',2'-bis(diethylamino)spiro[2H-isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 175720235 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 1',2'-bis(diethylamino)spiro[2H-isoindole-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc2c(c1N(CC)CC)C1(NC(=O)c3ccccc31)c1ccccc1O2 |
| InChI | InChI=1S/C28H31N3O2/c1-5-30(6-2)22-17-18-24-25(26(22)31(7-3)8-4)28(21-15-11-12-16-23(21)33-24)20-14-10-9-13-19(20)27(32)29-28/h9-18H,5-8H2,1-4H3,(H,29,32) |
| InChIKey | JICBADGGJOUKCJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |