C23H29N3O6 — CID 150738087
tert-butyl 5-[(3-cyclopropyl-3-oxopropanoyl)amino]-6-morpholin-4-yl-3-oxo-1H-isoindole-2-carboxylate (PubChem CID 150738087) has the molecular formula C23H29N3O6 and a molecular weight of 443.50 g/mol. Its IUPAC name is tert-butyl 5-[(3-cyclopropyl-3-oxopropanoyl)amino]-6-morpholin-4-yl-3-oxo-1H-isoindole-2-carboxylate.
| Compound Name | tert-butyl 5-[(3-cyclopropyl-3-oxopropanoyl)amino]-6-morpholin-4-yl-3-oxo-1H-isoindole-2-carboxylate |
|---|---|
| PubChem CID | 150738087 |
| Molecular Formula | C23H29N3O6 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | tert-butyl 5-[(3-cyclopropyl-3-oxopropanoyl)amino]-6-morpholin-4-yl-3-oxo-1H-isoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2cc(N3CCOCC3)c(NC(=O)CC(=O)C3CC3)cc2C1=O |
| InChI | InChI=1S/C23H29N3O6/c1-23(2,3)32-22(30)26-13-15-10-18(25-6-8-31-9-7-25)17(11-16(15)21(26)29)24-20(28)12-19(27)14-4-5-14/h10-11,14H,4-9,12-13H2,1-3H3,(H,24,28) |
| InChIKey | JTGDFLBDJXAVDU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|