C8H11N5O — CID 150775461
2-(2-methoxyethyl)-7H-purin-8-amine (PubChem CID 150775461) has the molecular formula C8H11N5O and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-7H-purin-8-amine.
| Compound Name | 2-(2-methoxyethyl)-7H-purin-8-amine |
|---|---|
| PubChem CID | 150775461 |
| Molecular Formula | C8H11N5O |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 2-(2-methoxyethyl)-7H-purin-8-amine |
| SMILES | COCCc1ncc2[nH]c(N)nc2n1 |
| InChI | InChI=1S/C8H11N5O/c1-14-3-2-6-10-4-5-7(12-6)13-8(9)11-5/h4H,2-3H2,1H3,(H3,9,10,11,12,13) |
| InChIKey | KATSTVHRHXFISP-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |