C8H12ClNO — CID 150804324
5-(chloromethyl)-1-methoxycyclohexa-2,4-dien-1-amine (PubChem CID 150804324) has the molecular formula C8H12ClNO and a molecular weight of 173.64 g/mol. Its IUPAC name is 5-(chloromethyl)-1-methoxycyclohexa-2,4-dien-1-amine.
| Compound Name | 5-(chloromethyl)-1-methoxycyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 150804324 |
| Molecular Formula | C8H12ClNO |
| Molecular Weight | 173.64 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 5-(chloromethyl)-1-methoxycyclohexa-2,4-dien-1-amine |
| SMILES | COC1(N)C=CC=C(CCl)C1 |
| InChI | InChI=1S/C8H12ClNO/c1-11-8(10)4-2-3-7(5-8)6-9/h2-4H,5-6,10H2,1H3 |
| InChIKey | KGNSBUCFOOXRRS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.64 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|