C20H35Cl2P — CID 152580482
4-[1,5-bis(chloromethyl)cyclohexa-2,4-dien-1-yl]butyl-dibutylphosphane (PubChem CID 152580482) has the molecular formula C20H35Cl2P and a molecular weight of 377.38 g/mol. Its IUPAC name is 4-[1,5-bis(chloromethyl)cyclohexa-2,4-dien-1-yl]butyl-dibutylphosphane.
| Compound Name | 4-[1,5-bis(chloromethyl)cyclohexa-2,4-dien-1-yl]butyl-dibutylphosphane |
|---|---|
| PubChem CID | 152580482 |
| Molecular Formula | C20H35Cl2P |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 4-[1,5-bis(chloromethyl)cyclohexa-2,4-dien-1-yl]butyl-dibutylphosphane |
| SMILES | CCCCP(CCCC)CCCCC1(CCl)C=CC=C(CCl)C1 |
| InChI | InChI=1S/C20H35Cl2P/c1-3-5-13-23(14-6-4-2)15-8-7-11-20(18-22)12-9-10-19(16-20)17-21/h9-10,12H,3-8,11,13-18H2,1-2H3 |
| InChIKey | YTJCQKYYUXSDPH-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|