C10H20N2 — CID 150811510
6-cyclopropylhept-5-ene-1,5-diamine (PubChem CID 150811510) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 6-cyclopropylhept-5-ene-1,5-diamine.
| Compound Name | 6-cyclopropylhept-5-ene-1,5-diamine |
|---|---|
| PubChem CID | 150811510 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 6-cyclopropylhept-5-ene-1,5-diamine |
| SMILES | CC(=C(N)CCCCN)C1CC1 |
| InChI | InChI=1S/C10H20N2/c1-8(9-5-6-9)10(12)4-2-3-7-11/h9H,2-7,11-12H2,1H3 |
| InChIKey | KHZNMUZZQHMGBW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|