C19H32OS — CID 150818218
4-[(E)-4-(2,2-dimethyl-6-methylidenecyclohexyl)but-3-en-2-yl]sulfanyl-4-methylpentan-2-one (PubChem CID 150818218) has the molecular formula C19H32OS and a molecular weight of 308.53 g/mol. Its IUPAC name is 4-[(E)-4-(2,2-dimethyl-6-methylidenecyclohexyl)but-3-en-2-yl]sulfanyl-4-methylpentan-2-one.
| Compound Name | 4-[(E)-4-(2,2-dimethyl-6-methylidenecyclohexyl)but-3-en-2-yl]sulfanyl-4-methylpentan-2-one |
|---|---|
| PubChem CID | 150818218 |
| Molecular Formula | C19H32OS |
| Molecular Weight | 308.53 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 4-[(E)-4-(2,2-dimethyl-6-methylidenecyclohexyl)but-3-en-2-yl]sulfanyl-4-methylpentan-2-one |
| SMILES | C=C1CCCC(C)(C)C1/C=C/C(C)SC(C)(C)CC(C)=O |
| InChI | InChI=1S/C19H32OS/c1-14-9-8-12-18(4,5)17(14)11-10-16(3)21-19(6,7)13-15(2)20/h10-11,16-17H,1,8-9,12-13H2,2-7H3/b11-10+ |
| InChIKey | KJIVGLQXQXHJEQ-ZHACJKMWSA-N |
| XLogP | 5.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|