C18H16ClFN4 — CID 150844643
8-chloro-1-ethyl-6-(2-fluorophenyl)-2,4-dihydroimidazo[4,5-g][2,3]benzodiazepine (PubChem CID 150844643) has the molecular formula C18H16ClFN4 and a molecular weight of 342.81 g/mol. Its IUPAC name is 8-chloro-1-ethyl-6-(2-fluorophenyl)-2,4-dihydroimidazo[4,5-g][2,3]benzodiazepine.
| Compound Name | 8-chloro-1-ethyl-6-(2-fluorophenyl)-2,4-dihydroimidazo[4,5-g][2,3]benzodiazepine |
|---|---|
| PubChem CID | 150844643 |
| Molecular Formula | C18H16ClFN4 |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 8-chloro-1-ethyl-6-(2-fluorophenyl)-2,4-dihydroimidazo[4,5-g][2,3]benzodiazepine |
| SMILES | CCN1CN=C2CC=C3C(c4ccccc4F)=NN(Cl)C=CC3=C21 |
| InChI | InChI=1S/C18H16ClFN4/c1-2-23-11-21-16-8-7-12-13(18(16)23)9-10-24(19)22-17(12)14-5-3-4-6-15(14)20/h3-7,9-10H,2,8,11H2,1H3 |
| InChIKey | KOSMXRVWZNEFCG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|