C19H19FN4 — CID 178156632
9-(4-fluorophenyl)-11-piperidin-1-yl-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene (PubChem CID 178156632) has the molecular formula C19H19FN4 and a molecular weight of 322.39 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-11-piperidin-1-yl-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene.
| Compound Name | 9-(4-fluorophenyl)-11-piperidin-1-yl-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene |
|---|---|
| PubChem CID | 178156632 |
| Molecular Formula | C19H19FN4 |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 9-(4-fluorophenyl)-11-piperidin-1-yl-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene |
| SMILES | Fc1ccc(C2=NC3=C=CCC=NN3C(N3CCCCC3)=C2)cc1 |
| InChI | InChI=1S/C19H19FN4/c20-16-9-7-15(8-10-16)17-14-19(23-12-4-1-5-13-23)24-18(22-17)6-2-3-11-21-24/h2,7-11,14H,1,3-5,12-13H2 |
| InChIKey | DBXVFVRQWJSSPZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |