C9H14N2O — CID 150846396
4,5-diethyl-1H-pyrrole-2-carboxamide (PubChem CID 150846396) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 4,5-diethyl-1H-pyrrole-2-carboxamide.
| Compound Name | 4,5-diethyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 150846396 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 4,5-diethyl-1H-pyrrole-2-carboxamide |
| SMILES | CCc1cc(C(N)=O)[nH]c1CC |
| InChI | InChI=1S/C9H14N2O/c1-3-6-5-8(9(10)12)11-7(6)4-2/h5,11H,3-4H2,1-2H3,(H2,10,12) |
| InChIKey | KPCASMBMWRRDHX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |