C22H42O4 — CID 150853964
2-(1,1-dipropoxyethyl)decyl 2-methylprop-2-enoate (PubChem CID 150853964) has the molecular formula C22H42O4 and a molecular weight of 370.57 g/mol. Its IUPAC name is 2-(1,1-dipropoxyethyl)decyl 2-methylprop-2-enoate.
| Compound Name | 2-(1,1-dipropoxyethyl)decyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 150853964 |
| Molecular Formula | C22H42O4 |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | 2-(1,1-dipropoxyethyl)decyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCCCCCCC)C(C)(OCCC)OCCC |
| InChI | InChI=1S/C22H42O4/c1-7-10-11-12-13-14-15-20(18-24-21(23)19(4)5)22(6,25-16-8-2)26-17-9-3/h20H,4,7-18H2,1-3,5-6H3 |
| InChIKey | KQPOUGYWFUEAPC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|