C20H16O9 — CID 150860243
3,6,13,14,17-pentaoxatricyclo[17.2.2.28,11]pentacosa-1(22),8,10,19(23),20,24-hexaene-2,7,12,18-tetrone (PubChem CID 150860243) has the molecular formula C20H16O9 and a molecular weight of 400.34 g/mol. Its IUPAC name is 3,6,13,14,17-pentaoxatricyclo[17.2.2.28,11]pentacosa-1(22),8,10,19(23),20,24-hexaene-2,7,12,18-tetrone.
| Compound Name | 3,6,13,14,17-pentaoxatricyclo[17.2.2.28,11]pentacosa-1(22),8,10,19(23),20,24-hexaene-2,7,12,18-tetrone |
|---|---|
| PubChem CID | 150860243 |
| Molecular Formula | C20H16O9 |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 3,6,13,14,17-pentaoxatricyclo[17.2.2.28,11]pentacosa-1(22),8,10,19(23),20,24-hexaene-2,7,12,18-tetrone |
| SMILES | O=C1OCCOOC(=O)c2ccc(cc2)C(=O)OCCOC(=O)c2ccc1cc2 |
| InChI | InChI=1S/C20H16O9/c21-17-13-1-3-14(4-2-13)19(23)27-11-12-28-29-20(24)16-7-5-15(6-8-16)18(22)26-10-9-25-17/h1-8H,9-12H2 |
| InChIKey | KRVVXCNHZGHIFP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|