C16H14FN3O2 — CID 150908329
4-ethyl-1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazole-3-carbaldehyde (PubChem CID 150908329) has the molecular formula C16H14FN3O2 and a molecular weight of 299.31 g/mol. Its IUPAC name is 4-ethyl-1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazole-3-carbaldehyde.
| Compound Name | 4-ethyl-1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazole-3-carbaldehyde |
|---|---|
| PubChem CID | 150908329 |
| Molecular Formula | C16H14FN3O2 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 4-ethyl-1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazole-3-carbaldehyde |
| SMILES | CCc1c(C=O)nn(Cc2ccccc2F)c1-c1ccon1 |
| InChI | InChI=1S/C16H14FN3O2/c1-2-12-15(10-21)18-20(16(12)14-7-8-22-19-14)9-11-5-3-4-6-13(11)17/h3-8,10H,2,9H2,1H3 |
| InChIKey | LBLNUQQETPENHB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|