C8H14N4O — CID 150911781
1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-2-amine (PubChem CID 150911781) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-2-amine.
| Compound Name | 1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-2-amine |
|---|---|
| PubChem CID | 150911781 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-2-amine |
| SMILES | Cc1nnc(N2CCCCC2N)o1 |
| InChI | InChI=1S/C8H14N4O/c1-6-10-11-8(13-6)12-5-3-2-4-7(12)9/h7H,2-5,9H2,1H3 |
| InChIKey | LCDKBRLOPNOVPF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |