C7H11N3O2 — CID 59594509
4-(5-methyl-1,3,4-oxadiazol-2-yl)morpholine (PubChem CID 59594509) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-(5-methyl-1,3,4-oxadiazol-2-yl)morpholine.
| Compound Name | 4-(5-methyl-1,3,4-oxadiazol-2-yl)morpholine |
|---|---|
| PubChem CID | 59594509 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 4-(5-methyl-1,3,4-oxadiazol-2-yl)morpholine |
| SMILES | Cc1nnc(N2CCOCC2)o1 |
| InChI | InChI=1S/C7H11N3O2/c1-6-8-9-7(12-6)10-2-4-11-5-3-10/h2-5H2,1H3 |
| InChIKey | WOYDDNQSUPSGRF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |