C15H26O3 — CID 15091677
3-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)butyl]cyclohexan-1-one (PubChem CID 15091677) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 3-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)butyl]cyclohexan-1-one.
| Compound Name | 3-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)butyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 15091677 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 3-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)butyl]cyclohexan-1-one |
| SMILES | CC1(C)OCC(CCCCC2CCCC(=O)C2)O1 |
| InChI | InChI=1S/C15H26O3/c1-15(2)17-11-14(18-15)9-4-3-6-12-7-5-8-13(16)10-12/h12,14H,3-11H2,1-2H3 |
| InChIKey | SEKDESXXJXUNOT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|