C26H20F3NO4 — CID 150926280
[2-[1-benzyl-5-[4-(trifluoromethoxy)phenyl]indol-3-yl]-2-oxoethyl] acetate (PubChem CID 150926280) has the molecular formula C26H20F3NO4 and a molecular weight of 467.44 g/mol. Its IUPAC name is [2-[1-benzyl-5-[4-(trifluoromethoxy)phenyl]indol-3-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[1-benzyl-5-[4-(trifluoromethoxy)phenyl]indol-3-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 150926280 |
| Molecular Formula | C26H20F3NO4 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | [2-[1-benzyl-5-[4-(trifluoromethoxy)phenyl]indol-3-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)c1cn(Cc2ccccc2)c2ccc(-c3ccc(OC(F)(F)F)cc3)cc12 |
| InChI | InChI=1S/C26H20F3NO4/c1-17(31)33-16-25(32)23-15-30(14-18-5-3-2-4-6-18)24-12-9-20(13-22(23)24)19-7-10-21(11-8-19)34-26(27,28)29/h2-13,15H,14,16H2,1H3 |
| InChIKey | LFCAYSDITNSCBY-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |