C8H7NO3S — CID 150934673
1-hydroxy-3-thiophen-2-ylpyrrolidine-2,5-dione (PubChem CID 150934673) has the molecular formula C8H7NO3S and a molecular weight of 197.22 g/mol. Its IUPAC name is 1-hydroxy-3-thiophen-2-ylpyrrolidine-2,5-dione.
| Compound Name | 1-hydroxy-3-thiophen-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 150934673 |
| Molecular Formula | C8H7NO3S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 1-hydroxy-3-thiophen-2-ylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(c2cccs2)C(=O)N1O |
| InChI | InChI=1S/C8H7NO3S/c10-7-4-5(8(11)9(7)12)6-2-1-3-13-6/h1-3,5,12H,4H2 |
| InChIKey | LGTREGPLZJITNF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|