C15H21F3O3 — CID 15093674
ethyl 2-[2-(cyclohexen-1-yl)ethyl]-4,4,4-trifluoro-2-methyl-3-oxobutanoate (PubChem CID 15093674) has the molecular formula C15H21F3O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is ethyl 2-[2-(cyclohexen-1-yl)ethyl]-4,4,4-trifluoro-2-methyl-3-oxobutanoate.
| Compound Name | ethyl 2-[2-(cyclohexen-1-yl)ethyl]-4,4,4-trifluoro-2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 15093674 |
| Molecular Formula | C15H21F3O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | ethyl 2-[2-(cyclohexen-1-yl)ethyl]-4,4,4-trifluoro-2-methyl-3-oxobutanoate |
| SMILES | CCOC(=O)C(C)(CCC1=CCCCC1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H21F3O3/c1-3-21-13(20)14(2,12(19)15(16,17)18)10-9-11-7-5-4-6-8-11/h7H,3-6,8-10H2,1-2H3 |
| InChIKey | JRWKHJVUYQUYIB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|