C14H19F3O3 — CID 15093679
ethyl 2-(cyclohexen-1-ylmethyl)-4,4,4-trifluoro-2-methyl-3-oxobutanoate (PubChem CID 15093679) has the molecular formula C14H19F3O3 and a molecular weight of 292.30 g/mol. Its IUPAC name is ethyl 2-(cyclohexen-1-ylmethyl)-4,4,4-trifluoro-2-methyl-3-oxobutanoate.
| Compound Name | ethyl 2-(cyclohexen-1-ylmethyl)-4,4,4-trifluoro-2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 15093679 |
| Molecular Formula | C14H19F3O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | ethyl 2-(cyclohexen-1-ylmethyl)-4,4,4-trifluoro-2-methyl-3-oxobutanoate |
| SMILES | CCOC(=O)C(C)(CC1=CCCCC1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C14H19F3O3/c1-3-20-12(19)13(2,11(18)14(15,16)17)9-10-7-5-4-6-8-10/h7H,3-6,8-9H2,1-2H3 |
| InChIKey | VXZQZTJCQLMFPQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|