C13H11N3O2S — CID 15094754
3-benzyl-6-methyl-[1,3]thiazolo[4,5-d]pyridazine-2,7-dione (PubChem CID 15094754) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is 3-benzyl-6-methyl-[1,3]thiazolo[4,5-d]pyridazine-2,7-dione.
| Compound Name | 3-benzyl-6-methyl-[1,3]thiazolo[4,5-d]pyridazine-2,7-dione |
|---|---|
| PubChem CID | 15094754 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3-benzyl-6-methyl-[1,3]thiazolo[4,5-d]pyridazine-2,7-dione |
| SMILES | Cn1ncc2c(sc(=O)n2Cc2ccccc2)c1=O |
| InChI | InChI=1S/C13H11N3O2S/c1-15-12(17)11-10(7-14-15)16(13(18)19-11)8-9-5-3-2-4-6-9/h2-7H,8H2,1H3 |
| InChIKey | IYDWUKHJIZLLHO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |