C12H16N2O4S — CID 150963148
ethyl 4-methyl-3-(2-oxoimidazolidin-1-yl)benzenesulfonate (PubChem CID 150963148) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is ethyl 4-methyl-3-(2-oxoimidazolidin-1-yl)benzenesulfonate.
| Compound Name | ethyl 4-methyl-3-(2-oxoimidazolidin-1-yl)benzenesulfonate |
|---|---|
| PubChem CID | 150963148 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | ethyl 4-methyl-3-(2-oxoimidazolidin-1-yl)benzenesulfonate |
| SMILES | CCOS(=O)(=O)c1ccc(C)c(N2CCNC2=O)c1 |
| InChI | InChI=1S/C12H16N2O4S/c1-3-18-19(16,17)10-5-4-9(2)11(8-10)14-7-6-13-12(14)15/h4-5,8H,3,6-7H2,1-2H3,(H,13,15) |
| InChIKey | LMNFZYHQGQQSNN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|