C28H40N2O4 — CID 150964358
[(2S)-2-carbamoyloxy-7,7-dimethyloctyl] N,N-bis[(4-methylphenyl)methyl]carbamate (PubChem CID 150964358) has the molecular formula C28H40N2O4 and a molecular weight of 468.64 g/mol. Its IUPAC name is [(2S)-2-carbamoyloxy-7,7-dimethyloctyl] N,N-bis[(4-methylphenyl)methyl]carbamate.
| Compound Name | [(2S)-2-carbamoyloxy-7,7-dimethyloctyl] N,N-bis[(4-methylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 150964358 |
| Molecular Formula | C28H40N2O4 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | [(2S)-2-carbamoyloxy-7,7-dimethyloctyl] N,N-bis[(4-methylphenyl)methyl]carbamate |
| SMILES | Cc1ccc(CN(Cc2ccc(C)cc2)C(=O)OC[C@H](CCCCC(C)(C)C)OC(N)=O)cc1 |
| InChI | InChI=1S/C28H40N2O4/c1-21-9-13-23(14-10-21)18-30(19-24-15-11-22(2)12-16-24)27(32)33-20-25(34-26(29)31)8-6-7-17-28(3,4)5/h9-16,25H,6-8,17-20H2,1-5H3,(H2,29,31)/t25-/m0/s1 |
| InChIKey | LMTNJHCPPCVMRC-VWLOTQADSA-N |
| XLogP | 6.51 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|