C13H20ClN3O3 — CID 160667231
[(2R)-1-[carbamoyl(methyl)carbamoyl]oxy-3-(4-methylphenyl)propan-2-yl]azanium chloride (PubChem CID 160667231) has the molecular formula C13H20ClN3O3 and a molecular weight of 301.77 g/mol. Its IUPAC name is [(2R)-1-[carbamoyl(methyl)carbamoyl]oxy-3-(4-methylphenyl)propan-2-yl]azanium chloride.
| Compound Name | [(2R)-1-[carbamoyl(methyl)carbamoyl]oxy-3-(4-methylphenyl)propan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 160667231 |
| Molecular Formula | C13H20ClN3O3 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | [(2R)-1-[carbamoyl(methyl)carbamoyl]oxy-3-(4-methylphenyl)propan-2-yl]azanium chloride |
| SMILES | Cc1ccc(C[C@@H]([NH3+])COC(=O)N(C)C(N)=O)cc1.[Cl-] |
| InChI | InChI=1S/C13H19N3O3.ClH/c1-9-3-5-10(6-4-9)7-11(14)8-19-13(18)16(2)12(15)17;/h3-6,11H,7-8,14H2,1-2H3,(H2,15,17);1H/t11-;/m1./s1 |
| InChIKey | OJHGQRFXMBIMAG-RFVHGSKJSA-N |
| XLogP | -2.70 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |