About 2-azidododec-1-ene
2-azidododec-1-ene (PubChem CID 150968655) has the molecular formula C12H23N3
and a molecular weight of 209.34 g/mol. Its IUPAC name is 2-azidododec-1-ene.
Molecular Properties
| Compound Name | 2-azidododec-1-ene |
| PubChem CID | 150968655 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 2-azidododec-1-ene |
| SMILES | C=C(CCCCCCCCCC)N=[N+]=[N-] |
| InChI | InChI=1S/C12H23N3/c1-3-4-5-6-7-8-9-10-11-12(2)14-15-13/h2-11H2,1H3 |
| InChIKey | LNQFJKCLWBSVNT-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azidododec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azidododec-1-ene?
The IUPAC name of 2-azidododec-1-ene (CID 150968655) is 2-azidododec-1-ene.
What is the SMILES notation for 2-azidododec-1-ene?
The canonical SMILES for 2-azidododec-1-ene is C=C(CCCCCCCCCC)N=[N+]=[N-].
What is the InChIKey of 2-azidododec-1-ene?
The InChIKey is LNQFJKCLWBSVNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3/c1-3-4-5-6-7-8-9-10-11-12(2)14-15-13/h2-11H2,1H3.
What are the key properties of 2-azidododec-1-ene?
2-azidododec-1-ene has a molecular weight of 209.34 g/mol, XLogP of 5.34, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azidododec-1-ene is sourced from PubChem (CID 150968655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).